3-(3,5-di-tert-butyl-4-hydroxyphenyl)-N'-{[4-(dimethylamino)phenyl]methylidene}propanehydrazide
Chemical Structure Depiction of
3-(3,5-di-tert-butyl-4-hydroxyphenyl)-N'-{[4-(dimethylamino)phenyl]methylidene}propanehydrazide
3-(3,5-di-tert-butyl-4-hydroxyphenyl)-N'-{[4-(dimethylamino)phenyl]methylidene}propanehydrazide
Compound characteristics
| Compound ID: | Y510-2243 |
| Compound Name: | 3-(3,5-di-tert-butyl-4-hydroxyphenyl)-N'-{[4-(dimethylamino)phenyl]methylidene}propanehydrazide |
| Molecular Weight: | 423.6 |
| Molecular Formula: | C26 H37 N3 O2 |
| Smiles: | CC(C)(C)c1cc(CCC(N/N=C/c2ccc(cc2)N(C)C)=O)cc(c1O)C(C)(C)C |
| Stereo: | ACHIRAL |
| logP: | 5.7066 |
| logD: | 5.7054 |
| logSw: | -5.2262 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.625 |
| InChI Key: | VHMXKSNCPBUPFR-UHFFFAOYSA-N |