2-[(1,3-benzothiazol-2-yl)sulfanyl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-[(1,3-benzothiazol-2-yl)sulfanyl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide
2-[(1,3-benzothiazol-2-yl)sulfanyl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | Y510-4516 |
| Compound Name: | 2-[(1,3-benzothiazol-2-yl)sulfanyl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 436.4 |
| Molecular Formula: | C17 H10 F6 N2 O S2 |
| Smiles: | C(C(Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F)=O)Sc1nc2ccccc2s1 |
| Stereo: | ACHIRAL |
| logP: | 6.3181 |
| logD: | 6.2233 |
| logSw: | -6.0478 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.198 |
| InChI Key: | BMTHLSUCWLDVFF-UHFFFAOYSA-N |