ethyl 2-(4-bromo-2-formylphenoxy)propanoate
Chemical Structure Depiction of
ethyl 2-(4-bromo-2-formylphenoxy)propanoate
ethyl 2-(4-bromo-2-formylphenoxy)propanoate
Compound characteristics
| Compound ID: | Y510-5637 |
| Compound Name: | ethyl 2-(4-bromo-2-formylphenoxy)propanoate |
| Molecular Weight: | 301.13 |
| Molecular Formula: | C12 H13 Br O4 |
| Smiles: | CCOC(C(C)Oc1ccc(cc1C=O)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.88 |
| logD: | 2.88 |
| logSw: | -3.057 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.03 |
| InChI Key: | SYJNEUOJPGCSMY-QMMMGPOBSA-N |